CAS 55034-12-3 is the registry number for 1-Bromo-2,5-dimethoxy-3-nitrobenzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-2,5-dimethoxy-3-nitrobenzene (CAS 55034-12-3) is a chemical compound with the molecular formula C8H8BrNO4 and a molecular weight of 262.06 g/mol. IUPAC name: 1-bromo-2,5-dimethoxy-3-nitrobenzene. InChIKey: QSEWGOVLIQAGQY-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO4 |
|---|---|
| Molecular weight | 262.06 g/mol |
| IUPAC name | 1-bromo-2,5-dimethoxy-3-nitrobenzene |
| InChIKey | QSEWGOVLIQAGQY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Br)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)