CAS 2121448-41-5 is the registry number for Dimethyl 3-bromo-1H-pyrrole-2,5-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl 3-bromo-1H-pyrrole-2,5-dicarboxylate (CAS 2121448-41-5) is a chemical compound with the molecular formula C8H8BrNO4 and a molecular weight of 262.06 g/mol. IUPAC name: dimethyl 3-bromo-1H-pyrrole-2,5-dicarboxylate. InChIKey: WRSDFYUJGCOWCW-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO4 |
|---|---|
| Molecular weight | 262.06 g/mol |
| IUPAC name | dimethyl 3-bromo-1H-pyrrole-2,5-dicarboxylate |
| InChIKey | WRSDFYUJGCOWCW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N1)C(=O)OC)Br |
Computed by PubChem (NCBI)