CAS 1103843-16-8 is the registry number for (5-Bromofuran-2-carbonyl)-L-alanine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[(5-bromofuran-2-carbonyl)amino]propanoic acid (CAS 1103843-16-8) is a chemical compound with the molecular formula C8H8BrNO4 and a molecular weight of 262.06 g/mol. IUPAC name: (2S)-2-[(5-bromofuran-2-carbonyl)amino]propanoic acid. InChIKey: GUAOPSXCIOJRNN-BYPYZUCNSA-N.
| Molecular formula | C8H8BrNO4 |
|---|---|
| Molecular weight | 262.06 g/mol |
| IUPAC name | (2S)-2-[(5-bromofuran-2-carbonyl)amino]propanoic acid |
| InChIKey | GUAOPSXCIOJRNN-BYPYZUCNSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)C1=CC=C(O1)Br |
Computed by PubChem (NCBI)