cas: 70399-01-8 — see every product listed under this CAS number, including other names
1-Bromo-3-(isopropylsulfonyl)benzene, 98%, 98% (CAS 70399-01-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114E4Q-100mg |
| cas | 70399-01-8 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 491.60 Pln | |
| Chemat | 25g | 1830.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-3-propan-2-ylsulfonylbenzene (CAS 70399-01-8) is a chemical compound with the molecular formula C9H11BrO2S and a molecular weight of 263.15 g/mol. IUPAC name: 1-bromo-3-propan-2-ylsulfonylbenzene. InChIKey: XPYUPOJVBBWILU-UHFFFAOYSA-N.
| Molecular formula | C9H11BrO2S |
|---|---|
| Molecular weight | 263.15 g/mol |
| IUPAC name | 1-bromo-3-propan-2-ylsulfonylbenzene |
| InChIKey | XPYUPOJVBBWILU-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)