cas: 1004112-67-7 — see every product listed under this CAS number, including other names
1-Bromo-3-chloro-5-(difluoromethoxy)benzene 95% (CAS 1004112-67-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A887398-250mg |
| cas | 1004112-67-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 1037.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A887398 |
1-bromo-3-chloro-5-(difluoromethoxy)benzene (CAS 1004112-67-7) is a chemical compound with the molecular formula C7H4BrClF2O and a molecular weight of 257.46 g/mol. IUPAC name: 1-bromo-3-chloro-5-(difluoromethoxy)benzene. InChIKey: IVRGKKXJURVLGX-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClF2O |
|---|---|
| Molecular weight | 257.46 g/mol |
| IUPAC name | 1-bromo-3-chloro-5-(difluoromethoxy)benzene |
| InChIKey | IVRGKKXJURVLGX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Br)OC(F)F |
Computed by PubChem (NCBI)