cas: 51072-66-3 — see every product listed under this CAS number, including other names
1-Bromo-4,5-dimethoxy-2-nitrobenzene, 98%, 98% (CAS 51072-66-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114E5Q-100mg |
| cas | 51072-66-3 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 347.60 Pln | |
| Chemat | 250mg | 534.80 Pln | |
| Chemat | 500mg | 760.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-4,5-dimethoxy-2-nitrobenzene (CAS 51072-66-3) is a chemical compound with the molecular formula C8H8BrNO4 and a molecular weight of 262.06 g/mol. IUPAC name: 1-bromo-4,5-dimethoxy-2-nitrobenzene. InChIKey: DGUDEQARXVYDBS-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO4 |
|---|---|
| Molecular weight | 262.06 g/mol |
| IUPAC name | 1-bromo-4,5-dimethoxy-2-nitrobenzene |
| InChIKey | DGUDEQARXVYDBS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)[N+](=O)[O-])Br)OC |
Computed by PubChem (NCBI)