cas: 56425-85-5 — see every product listed under this CAS number, including other names
1-Bromo-4-(pentafluoroethoxy)benzene, 98% (CAS 56425-85-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F094729-250MG |
| cas | 56425-85-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 601.89 Pln | |
| Fluorochem | 25g | 2424.16 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-bromo-4-(1,1,2,2,2-pentafluoroethoxy)benzene (CAS 56425-85-5) is a chemical compound with the molecular formula C8H4BrF5O and a molecular weight of 291.01 g/mol. IUPAC name: 1-bromo-4-(1,1,2,2,2-pentafluoroethoxy)benzene. InChIKey: BGNSROFPLXZBJD-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF5O |
|---|---|
| Molecular weight | 291.01 g/mol |
| IUPAC name | 1-bromo-4-(1,1,2,2,2-pentafluoroethoxy)benzene |
| InChIKey | BGNSROFPLXZBJD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC(C(F)(F)F)(F)F)Br |
Computed by PubChem (NCBI)