1-Bromoanthracene 95%
cas: 7397-92-4 — see every product listed under this CAS number, including other names
1-Bromoanthracene 95% (CAS 7397-92-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A273616-100mg |
| cas | 7397-92-4 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 1037.88 Pln | |
| Ambeed | 1g | 2689.94 Pln | |
| Ambeed | 5g | 11951.50 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A273616 |
1-bromoanthracene (CAS 7397-92-4) is a chemical compound with the molecular formula C14H9Br and a molecular weight of 257.12 g/mol. IUPAC name: 1-bromoanthracene. InChIKey: XMWJLKOCNKJERQ-UHFFFAOYSA-N.
| Molecular formula | C14H9Br |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 1-bromoanthracene |
| InChIKey | XMWJLKOCNKJERQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C=CC=C3Br |
Computed by PubChem (NCBI)