cas: 7397-92-4 — see every product listed under this CAS number, including other names
1-Bromoanthracene, >97.0%(GC) (CAS 7397-92-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B2615-100MG |
| cas | 7397-92-4 |
| size | 100mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 100mg | 305.20 Pln | |
| TCI | 500mg | 1072.29 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
1-bromoanthracene (CAS 7397-92-4) is a chemical compound with the molecular formula C14H9Br and a molecular weight of 257.12 g/mol. IUPAC name: 1-bromoanthracene. InChIKey: XMWJLKOCNKJERQ-UHFFFAOYSA-N.
| Molecular formula | C14H9Br |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 1-bromoanthracene |
| InChIKey | XMWJLKOCNKJERQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C=CC=C3Br |
Computed by PubChem (NCBI)