cas: 7397-92-4 — see every product listed under this CAS number, including other names
1-BROMOANTHRACENE, 98% (CAS 7397-92-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F827903-100MG |
| cas | 7397-92-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 575.86 Pln | |
| Fluorochem | 250mg | 1039.24 Pln | |
| Fluorochem | 1g | 2840.68 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-bromoanthracene (CAS 7397-92-4) is a chemical compound with the molecular formula C14H9Br and a molecular weight of 257.12 g/mol. IUPAC name: 1-bromoanthracene. InChIKey: XMWJLKOCNKJERQ-UHFFFAOYSA-N.
| Molecular formula | C14H9Br |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 1-bromoanthracene |
| InChIKey | XMWJLKOCNKJERQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C=CC=C3Br |
Computed by PubChem (NCBI)