cas: 3336-43-4 — see every product listed under this CAS number, including other names
1-Chloroisoquinolin-4-ol, 95%, 95% (CAS 3336-43-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114E9N-100mg |
| cas | 3336-43-4 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 947.60 Pln | |
| Chemat | 5g | 2718.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-chloroisoquinolin-4-ol (CAS 3336-43-4) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 1-chloroisoquinolin-4-ol. InChIKey: JEVLGPVFFYUBRI-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 1-chloroisoquinolin-4-ol |
| InChIKey | JEVLGPVFFYUBRI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=C2Cl)O |
Computed by PubChem (NCBI)