CAS 101774-33-8 appears in our catalog under these names: 3-Chloroisoquinolin-4-ol, 98%, 3-Chloro-4-isoquinolinol, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
3-chloroisoquinolin-4-ol (CAS 101774-33-8) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 3-chloroisoquinolin-4-ol. InChIKey: HLMAYSDUIAOBQE-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 3-chloroisoquinolin-4-ol |
| InChIKey | HLMAYSDUIAOBQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NC(=C2O)Cl |
Computed by PubChem (NCBI)