cas: 1596367-55-3 — see every product listed under this CAS number, including other names
1-Cyclopropyl-6-oxo-1,6-dihydropyridine-3-boronic Acid Pinacol Ester 98% (CAS 1596367-55-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A345263-50mg |
| cas | 1596367-55-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 882.12 Pln | |
| Ambeed | 100mg | 1115.75 Pln | |
| Ambeed | 250mg | 2033.56 Pln | |
| Ambeed | 1g | 5148.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A345263 |
1-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one (CAS 1596367-55-3) is a chemical compound with the molecular formula C14H20BNO3 and a molecular weight of 261.13 g/mol. IUPAC name: 1-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one. InChIKey: PSQKCGSTAZGHCJ-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO3 |
|---|---|
| Molecular weight | 261.13 g/mol |
| IUPAC name | 1-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
| InChIKey | PSQKCGSTAZGHCJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C(=O)C=C2)C3CC3 |
Computed by PubChem (NCBI)