cas: 3094-08-4 — see every product listed under this CAS number, including other names
1-Ethoxy-4-nitro-2-(trifluoromethyl)benzene, 97%, 97% (CAS 3094-08-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1142Q9-1g |
| cas | 3094-08-4 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 525.20 Pln | |
| Chemat | 10g | 904.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-ethoxy-4-nitro-2-(trifluoromethyl)benzene (CAS 3094-08-4) is a chemical compound with the molecular formula C9H8F3NO3 and a molecular weight of 235.16 g/mol. IUPAC name: 1-ethoxy-4-nitro-2-(trifluoromethyl)benzene. InChIKey: XWQUJLKVSQCZEG-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO3 |
|---|---|
| Molecular weight | 235.16 g/mol |
| IUPAC name | 1-ethoxy-4-nitro-2-(trifluoromethyl)benzene |
| InChIKey | XWQUJLKVSQCZEG-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)