CAS 655-08-3 is the registry number for 1-Ethoxy-2-nitro-4-(trifluoromethyl)benzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 5g, 1g.
1-ethoxy-2-nitro-4-(trifluoromethyl)benzene (CAS 655-08-3) is a chemical compound with the molecular formula C9H8F3NO3 and a molecular weight of 235.16 g/mol. IUPAC name: 1-ethoxy-2-nitro-4-(trifluoromethyl)benzene. InChIKey: AKLSDZQCGRHYNP-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO3 |
|---|---|
| Molecular weight | 235.16 g/mol |
| IUPAC name | 1-ethoxy-2-nitro-4-(trifluoromethyl)benzene |
| InChIKey | AKLSDZQCGRHYNP-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)