CAS 1228569-10-5 appears in our catalog under these names: (2R)-2-Amino-2-[3-(trifluoromethoxy)phenyl]acetic acid, 95%, (R)-2-Amino-2-(3-(trifluoromethoxy)phenyl)acetic acid, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 500mg.
(2R)-2-amino-2-[3-(trifluoromethoxy)phenyl]acetic acid (CAS 1228569-10-5) is a chemical compound with the molecular formula C9H8F3NO3 and a molecular weight of 235.16 g/mol. IUPAC name: (2R)-2-amino-2-[3-(trifluoromethoxy)phenyl]acetic acid. InChIKey: JSRHISPHWIGFLQ-SSDOTTSWSA-N.
| Molecular formula | C9H8F3NO3 |
|---|---|
| Molecular weight | 235.16 g/mol |
| IUPAC name | (2R)-2-amino-2-[3-(trifluoromethoxy)phenyl]acetic acid |
| InChIKey | JSRHISPHWIGFLQ-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)