cas: 331717-63-6 — see every product listed under this CAS number, including other names
1-Ethyl-3-methyl-1H-imidazol-3-ium thiocyanate 98% (CAS 331717-63-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A696784-5g |
| cas | 331717-63-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 136.75 Pln | |
| Ambeed | 25g | 281.38 Pln | |
| Ambeed | 100g | 826.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A696784 |
1-ethyl-3-methylimidazol-3-ium thiocyanate (CAS 331717-63-6) is a chemical compound with the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. IUPAC name: 1-ethyl-3-methylimidazol-3-ium thiocyanate. InChIKey: VASPYXGQVWPGAB-UHFFFAOYSA-M.
| Molecular formula | C7H11N3S |
|---|---|
| Molecular weight | 169.25 g/mol |
| IUPAC name | 1-ethyl-3-methylimidazol-3-ium thiocyanate |
| InChIKey | VASPYXGQVWPGAB-UHFFFAOYSA-M |
| SMILES | CCN1C=C[N+](=C1)C.C(#N)[S-] |
Computed by PubChem (NCBI)