cas: 328090-25-1 — see every product listed under this CAS number, including other names
1-Ethyl-3-methylimidazolium p-Toluenesulfonate, 97%, 97% (CAS 328090-25-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114B2Q-1g |
| cas | 328090-25-1 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 107.60 Pln | |
| Chemat | 25g | 165.20 Pln | |
| Chemat | 100g | 448.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-ethyl-3-methylimidazol-3-ium;4-methylbenzenesulfonate (CAS 328090-25-1) is a chemical compound with the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. IUPAC name: 1-ethyl-3-methylimidazol-3-ium;4-methylbenzenesulfonate. InChIKey: HXMUPILCYSJMLQ-UHFFFAOYSA-M.
| Molecular formula | C13H18N2O3S |
|---|---|
| Molecular weight | 282.36 g/mol |
| IUPAC name | 1-ethyl-3-methylimidazol-3-ium;4-methylbenzenesulfonate |
| InChIKey | HXMUPILCYSJMLQ-UHFFFAOYSA-M |
| SMILES | CCN1C=C[N+](=C1)C.CC1=CC=C(C=C1)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)