cas: 328090-25-1 — see every product listed under this CAS number, including other names
1-Ethyl-3-methylimidazolium p-Toluenesulfonate, >98.0%(HPLC) (CAS 328090-25-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | E0651-5G |
| cas | 328090-25-1 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 349.46 Pln | |
| TCI | 25g | 1096.88 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC) |
1-ethyl-3-methylimidazol-3-ium;4-methylbenzenesulfonate (CAS 328090-25-1) is a chemical compound with the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. IUPAC name: 1-ethyl-3-methylimidazol-3-ium;4-methylbenzenesulfonate. InChIKey: HXMUPILCYSJMLQ-UHFFFAOYSA-M.
| Molecular formula | C13H18N2O3S |
|---|---|
| Molecular weight | 282.36 g/mol |
| IUPAC name | 1-ethyl-3-methylimidazol-3-ium;4-methylbenzenesulfonate |
| InChIKey | HXMUPILCYSJMLQ-UHFFFAOYSA-M |
| SMILES | CCN1C=C[N+](=C1)C.CC1=CC=C(C=C1)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)