CAS 1197193-26-2 appears in our catalog under these names: 4–(4–Methyl–1–piperazinyl)–2–(methylsulfonyl)benzaldehyde, 4-(4-Methyl-1-piperazinyl)-2-(methylsulfonyl)benzaldehyde, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 250mg.
4-(4-methylpiperazin-1-yl)-2-methylsulfonylbenzaldehyde (CAS 1197193-26-2) is a chemical compound with the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. IUPAC name: 4-(4-methylpiperazin-1-yl)-2-methylsulfonylbenzaldehyde. InChIKey: RGSLNJIEVKCBHC-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O3S |
|---|---|
| Molecular weight | 282.36 g/mol |
| IUPAC name | 4-(4-methylpiperazin-1-yl)-2-methylsulfonylbenzaldehyde |
| InChIKey | RGSLNJIEVKCBHC-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC(=C(C=C2)C=O)S(=O)(=O)C |
Computed by PubChem (NCBI)