cas: 328090-25-1 — see every product listed under this CAS number, including other names
1-Ethyl-3-methyl-1H-imidazol-3-ium 4-methylbenzenesulfonate, 98% (CAS 328090-25-1) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F322057-100G |
| cas | 328090-25-1 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100g | 575.86 Pln | |
| Fluorochem | 500g | 2533.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-ethyl-3-methylimidazol-3-ium;4-methylbenzenesulfonate (CAS 328090-25-1) is a chemical compound with the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. IUPAC name: 1-ethyl-3-methylimidazol-3-ium;4-methylbenzenesulfonate. InChIKey: HXMUPILCYSJMLQ-UHFFFAOYSA-M.
| Molecular formula | C13H18N2O3S |
|---|---|
| Molecular weight | 282.36 g/mol |
| IUPAC name | 1-ethyl-3-methylimidazol-3-ium;4-methylbenzenesulfonate |
| InChIKey | HXMUPILCYSJMLQ-UHFFFAOYSA-M |
| SMILES | CCN1C=C[N+](=C1)C.CC1=CC=C(C=C1)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)