CAS 328090-25-1 appears in our catalog under these names: 1-ETHYL-3-METHYLIMIDAZOLIUM TOSYLATE&, 1-Ethyl-3-methylimidazolium p-toluenesulfonate, 97%, 1-Ethyl-3-methylimidazolium tosylate, 95-<97%, 1-Ethyl-3-methylimidazolium tosylate, ≥97-<99%, 1–Ethyl–3–methyl–1H–imidazol–3–ium 4–methylbenzenesulfonate. Offered by: Sigma-Aldrich, Combi-blocks, Hoffman Fine Chemicals, GLPBio, TCI. Available pack sizes: 50G, 5G, 25g, 100g, 1g, 600g, 500g, 10g.
1-ethyl-3-methylimidazol-3-ium;4-methylbenzenesulfonate (CAS 328090-25-1) is a chemical compound with the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. IUPAC name: 1-ethyl-3-methylimidazol-3-ium;4-methylbenzenesulfonate. InChIKey: HXMUPILCYSJMLQ-UHFFFAOYSA-M.
| Molecular formula | C13H18N2O3S |
|---|---|
| Molecular weight | 282.36 g/mol |
| IUPAC name | 1-ethyl-3-methylimidazol-3-ium;4-methylbenzenesulfonate |
| InChIKey | HXMUPILCYSJMLQ-UHFFFAOYSA-M |
| SMILES | CCN1C=C[N+](=C1)C.CC1=CC=C(C=C1)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)