cas: 1004643-70-2 — see every product listed under this CAS number, including other names
1-Ethyl-5-trifluoromethyl-1 H -pyrazole-3-carboxylic acid (CAS 1004643-70-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F027829-50MG |
| cas | 1004643-70-2 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 2658.46 Pln | |
| Fluorochem | 250mg | 3246.79 Pln |
| delivery time | 2-3 weeks |
|---|
1-ethyl-5-(trifluoromethyl)pyrazole-3-carboxylic acid (CAS 1004643-70-2) is a chemical compound with the molecular formula C7H7F3N2O2 and a molecular weight of 208.14 g/mol. IUPAC name: 1-ethyl-5-(trifluoromethyl)pyrazole-3-carboxylic acid. InChIKey: BJLMBVOXZSMLJE-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O2 |
|---|---|
| Molecular weight | 208.14 g/mol |
| IUPAC name | 1-ethyl-5-(trifluoromethyl)pyrazole-3-carboxylic acid |
| InChIKey | BJLMBVOXZSMLJE-UHFFFAOYSA-N |
| SMILES | CCN1C(=CC(=N1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)