CAS 1004643-70-2 appears in our catalog under these names: 1-Ethyl-5-(trifluoromethyl)-1h-pyrazole-3-carboxylic acid, 95%, 1-Ethyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid, 1-Ethyl-5-trifluoromethyl-1 H -pyrazole-3-carboxylic acid. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 50mg.
1-ethyl-5-(trifluoromethyl)pyrazole-3-carboxylic acid (CAS 1004643-70-2) is a chemical compound with the molecular formula C7H7F3N2O2 and a molecular weight of 208.14 g/mol. IUPAC name: 1-ethyl-5-(trifluoromethyl)pyrazole-3-carboxylic acid. InChIKey: BJLMBVOXZSMLJE-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O2 |
|---|---|
| Molecular weight | 208.14 g/mol |
| IUPAC name | 1-ethyl-5-(trifluoromethyl)pyrazole-3-carboxylic acid |
| InChIKey | BJLMBVOXZSMLJE-UHFFFAOYSA-N |
| SMILES | CCN1C(=CC(=N1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)