CAS 2028143-83-9 is the registry number for 1-(3,3,3-Trifluoropropyl)-1H-imidazole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3,3,3-trifluoropropyl)imidazole-2-carboxylic acid (CAS 2028143-83-9) is a chemical compound with the molecular formula C7H7F3N2O2 and a molecular weight of 208.14 g/mol. IUPAC name: 1-(3,3,3-trifluoropropyl)imidazole-2-carboxylic acid. InChIKey: WTZRRTWGRXOTGY-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O2 |
|---|---|
| Molecular weight | 208.14 g/mol |
| IUPAC name | 1-(3,3,3-trifluoropropyl)imidazole-2-carboxylic acid |
| InChIKey | WTZRRTWGRXOTGY-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=N1)C(=O)O)CCC(F)(F)F |
Computed by PubChem (NCBI)