CAS 1245772-05-7 appears in our catalog under these names: 1-(3,3,3-Trifluoropropyl)-1H-pyrazole-5-carboxylic acid, 1-(3,3,3-Trifluoropropyl)-1H-pyrazole-5-carboxylic acid, 98%, 98%, 1-(3,3,3-Trifluoropropyl)-1H-pyrazole-5-carboxylic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
2-(3,3,3-trifluoropropyl)pyrazole-3-carboxylic acid (CAS 1245772-05-7) is a chemical compound with the molecular formula C7H7F3N2O2 and a molecular weight of 208.14 g/mol. IUPAC name: 2-(3,3,3-trifluoropropyl)pyrazole-3-carboxylic acid. InChIKey: LQTIZFMDLWJRNY-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O2 |
|---|---|
| Molecular weight | 208.14 g/mol |
| IUPAC name | 2-(3,3,3-trifluoropropyl)pyrazole-3-carboxylic acid |
| InChIKey | LQTIZFMDLWJRNY-UHFFFAOYSA-N |
| SMILES | C1=C(N(N=C1)CCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)