CAS 2379241-90-2 is the registry number for 3-(Trifluoromethyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-4-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(trifluoromethyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-4-ol (CAS 2379241-90-2) is a chemical compound with the molecular formula C7H7F3N2O2 and a molecular weight of 208.14 g/mol. IUPAC name: 3-(trifluoromethyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-4-ol. InChIKey: NTQLUFMMGJXIQM-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O2 |
|---|---|
| Molecular weight | 208.14 g/mol |
| IUPAC name | 3-(trifluoromethyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-4-ol |
| InChIKey | NTQLUFMMGJXIQM-UHFFFAOYSA-N |
| SMILES | C1COC(C2=C(C=NN21)C(F)(F)F)O |
Computed by PubChem (NCBI)