cas: 41252-98-6 — see every product listed under this CAS number, including other names
1-Iodo-2-methyl-3-nitrobenzene 98% (CAS 41252-98-6) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A114592-500g |
| cas | 41252-98-6 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 10127.00 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 25g | 1010.06 Pln | |
| Ambeed | 100g | 2584.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A114592 |
1-iodo-2-methyl-3-nitrobenzene (CAS 41252-98-6) is a chemical compound with the molecular formula C7H6INO2 and a molecular weight of 263.03 g/mol. IUPAC name: 1-iodo-2-methyl-3-nitrobenzene. InChIKey: ZVAKFJFOGUFJON-UHFFFAOYSA-N.
| Molecular formula | C7H6INO2 |
|---|---|
| Molecular weight | 263.03 g/mol |
| IUPAC name | 1-iodo-2-methyl-3-nitrobenzene |
| InChIKey | ZVAKFJFOGUFJON-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1I)[N+](=O)[O-] |
Computed by PubChem (NCBI)