cas: 3320-86-3 — see every product listed under this CAS number, including other names
1-Isocyanato-2-nitrobenzene (CAS 3320-86-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F044445-250MG |
| cas | 3320-86-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 544.62 Pln | |
| Fluorochem | 25g | 1752.53 Pln |
| delivery time | 3-4 weeks |
|---|
1-isocyanato-2-nitrobenzene (CAS 3320-86-3) is a chemical compound with the molecular formula C7H4N2O3 and a molecular weight of 164.12 g/mol. IUPAC name: 1-isocyanato-2-nitrobenzene. InChIKey: JRVZITODZAQRQM-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 1-isocyanato-2-nitrobenzene |
| InChIKey | JRVZITODZAQRQM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N=C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)