CAS 1804409-12-8 is the registry number for 5-Cyano-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-cyano-2-oxo-1H-pyridine-3-carboxylic acid (CAS 1804409-12-8) is a chemical compound with the molecular formula C7H4N2O3 and a molecular weight of 164.12 g/mol. IUPAC name: 5-cyano-2-oxo-1H-pyridine-3-carboxylic acid. InChIKey: XUTYOLCYDQFTFH-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 5-cyano-2-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | XUTYOLCYDQFTFH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC=C1C#N)C(=O)O |
Computed by PubChem (NCBI)