cas: 1341766-01-5 — see every product listed under this CAS number, including other names
1-Isopropyl-4-(trifluoromethyl)-1H-pyrrole-3-carboxylic acid, 95+% (CAS 1341766-01-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A649027-250mg |
| cas | 1341766-01-5 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 2745.61 Pln | |
| AmBeed | 1g | 6755.77 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-propan-2-yl-4-(trifluoromethyl)pyrrole-3-carboxylic acid (CAS 1341766-01-5) is a chemical compound with the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. IUPAC name: 1-propan-2-yl-4-(trifluoromethyl)pyrrole-3-carboxylic acid. InChIKey: VTCMJDWNRUCRSW-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO2 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | 1-propan-2-yl-4-(trifluoromethyl)pyrrole-3-carboxylic acid |
| InChIKey | VTCMJDWNRUCRSW-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=C(C(=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)