CAS 176910-42-2 is the registry number for 8-(2,2,2-Trifluoroacetyl)-8-azabicyclo[3.2.1]octan-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-(2,2,2-trifluoroacetyl)-8-azabicyclo[3.2.1]octan-3-one (CAS 176910-42-2) is a chemical compound with the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. IUPAC name: 8-(2,2,2-trifluoroacetyl)-8-azabicyclo[3.2.1]octan-3-one. InChIKey: VQAKWLUSFTURKR-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO2 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | 8-(2,2,2-trifluoroacetyl)-8-azabicyclo[3.2.1]octan-3-one |
| InChIKey | VQAKWLUSFTURKR-UHFFFAOYSA-N |
| SMILES | C1CC2CC(=O)CC1N2C(=O)C(F)(F)F |
Computed by PubChem (NCBI)