cas: 4900-63-4 — see every product listed under this CAS number, including other names
1-Methoxy-4-nitronaphthalene, 96% (CAS 4900-63-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F024298-5G |
| cas | 4900-63-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 206.20 Pln | |
| Fluorochem | 10g | 357.18 Pln | |
| Fluorochem | 25g | 690.40 Pln | |
| Fluorochem | 100g | 2330.45 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
1-methoxy-4-nitronaphthalene (CAS 4900-63-4) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 1-methoxy-4-nitronaphthalene. InChIKey: YFJKGPRYPHFGQD-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 1-methoxy-4-nitronaphthalene |
| InChIKey | YFJKGPRYPHFGQD-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C2=CC=CC=C21)[N+](=O)[O-] |
Computed by PubChem (NCBI)