Products 901926-44-1
CAS 901926-44-1 appears in our catalog under these names: 3-(3-methylphenyl)-1,2-oxazole-5-carboxylic acid, 95%, 3-(m-Tolyl)isoxazole-5-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(3-methylphenyl)-1,2-oxazole-5-carboxylic acid (CAS 901926-44-1) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 3-(3-methylphenyl)-1,2-oxazole-5-carboxylic acid. InChIKey: PDDMXZJKQIWUNQ-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 3-(3-methylphenyl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | PDDMXZJKQIWUNQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NOC(=C2)C(=O)O |
Computed by PubChem (NCBI)