CAS 933709-27-4 is the registry number for 3-(4-Methoxyphenyl)-1,2-oxazole-5-carbaldehyde, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(4-methoxyphenyl)-1,2-oxazole-5-carbaldehyde (CAS 933709-27-4) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 3-(4-methoxyphenyl)-1,2-oxazole-5-carbaldehyde. InChIKey: KAKLXOGRVNKBQR-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)-1,2-oxazole-5-carbaldehyde |
| InChIKey | KAKLXOGRVNKBQR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NOC(=C2)C=O |
Computed by PubChem (NCBI)