CAS 35966-17-7 appears in our catalog under these names: 4-Hydroxy-8-methylquinoline-3-carboxylic acid, 98%, 4-Hydroxy-8-methylquinoline-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 100g, 5g, 10g.
8-methyl-4-oxo-1H-quinoline-3-carboxylic acid (CAS 35966-17-7) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 8-methyl-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: UJIRBIMPTSELQD-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 8-methyl-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | UJIRBIMPTSELQD-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)