Products 21141-35-5
CAS 21141-35-5 appears in our catalog under these names: 8-Methoxyquinoline-2-carboxylic acid, 95%, 8–Methoxyquinoline–2–carboxylic acid, 8-Methoxyquinoline-2-carboxylic acid, 8-Methoxyquinoline-2-carboxylic acid 95%, 8-Methoxyquinoline-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 250mg, 100mg, 0,5g.
8-methoxyquinoline-2-carboxylic acid (CAS 21141-35-5) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 8-methoxyquinoline-2-carboxylic acid. InChIKey: RAZRTJLTLNPWKV-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 8-methoxyquinoline-2-carboxylic acid |
| InChIKey | RAZRTJLTLNPWKV-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1N=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)