cas: 136622-67-8 — see every product listed under this CAS number, including other names
1-Methyl-7-(trifluoromethyl)indoline-2,3-dione 97% (CAS 136622-67-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A426793-100mg |
| cas | 136622-67-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 826.50 Pln | |
| Ambeed | 5g | 2361.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A426793 |
1-methyl-7-(trifluoromethyl)indole-2,3-dione (CAS 136622-67-8) is a chemical compound with the molecular formula C10H6F3NO2 and a molecular weight of 229.15 g/mol. IUPAC name: 1-methyl-7-(trifluoromethyl)indole-2,3-dione. InChIKey: JAXOXOOOXCOXAN-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO2 |
|---|---|
| Molecular weight | 229.15 g/mol |
| IUPAC name | 1-methyl-7-(trifluoromethyl)indole-2,3-dione |
| InChIKey | JAXOXOOOXCOXAN-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC=C2C(F)(F)F)C(=O)C1=O |
Computed by PubChem (NCBI)