CAS 327-20-8 appears in our catalog under these names: 6-(Trifluoromethyl)indole-2-carboxylic acid, 95%, 6-(Trifluoromethyl)-1H-indole-2-carboxylic acid, 97%, 97%, 6-(Trifluoromethyl)-1H-indole-2-carboxylic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 250mg, 50mg, 100mg, 500mg.
6-(trifluoromethyl)-1H-indole-2-carboxylic acid (CAS 327-20-8) is a chemical compound with the molecular formula C10H6F3NO2 and a molecular weight of 229.15 g/mol. IUPAC name: 6-(trifluoromethyl)-1H-indole-2-carboxylic acid. InChIKey: CDWGDLKZKCYUFO-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO2 |
|---|---|
| Molecular weight | 229.15 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1H-indole-2-carboxylic acid |
| InChIKey | CDWGDLKZKCYUFO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)NC(=C2)C(=O)O |
Computed by PubChem (NCBI)