CAS 73496-29-4 is the registry number for 4-(Trifluoromethyl)quinoline-2,7-diol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
7-hydroxy-4-(trifluoromethyl)-1H-quinolin-2-one (CAS 73496-29-4) is a chemical compound with the molecular formula C10H6F3NO2 and a molecular weight of 229.15 g/mol. IUPAC name: 7-hydroxy-4-(trifluoromethyl)-1H-quinolin-2-one. InChIKey: XAGSNZIBWDMNBS-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO2 |
|---|---|
| Molecular weight | 229.15 g/mol |
| IUPAC name | 7-hydroxy-4-(trifluoromethyl)-1H-quinolin-2-one |
| InChIKey | XAGSNZIBWDMNBS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)NC(=O)C=C2C(F)(F)F |
Computed by PubChem (NCBI)