CAS 875306-19-7 appears in our catalog under these names: 5-(Trifluoromethyl)-1h-indole-7-carboxylic acid, 95%, 5-(Trifluoromethyl)-1H-indole-7-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
5-(trifluoromethyl)-1H-indole-7-carboxylic acid (CAS 875306-19-7) is a chemical compound with the molecular formula C10H6F3NO2 and a molecular weight of 229.15 g/mol. IUPAC name: 5-(trifluoromethyl)-1H-indole-7-carboxylic acid. InChIKey: MEAOZPVNHLARQW-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO2 |
|---|---|
| Molecular weight | 229.15 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1H-indole-7-carboxylic acid |
| InChIKey | MEAOZPVNHLARQW-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C(C=C(C=C21)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)