CAS 136622-67-8 appears in our catalog under these names: 1-Methyl-7-(trifluoromethyl)-1h-indole-2,3-dione, 95%, 1-Methyl-7-(trifluoromethyl)-1H-indole-2,3-dione, 95%, 95%, 1-Methyl-7-(trifluoromethyl)indoline-2,3-dione, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-methyl-7-(trifluoromethyl)indole-2,3-dione (CAS 136622-67-8) is a chemical compound with the molecular formula C10H6F3NO2 and a molecular weight of 229.15 g/mol. IUPAC name: 1-methyl-7-(trifluoromethyl)indole-2,3-dione. InChIKey: JAXOXOOOXCOXAN-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO2 |
|---|---|
| Molecular weight | 229.15 g/mol |
| IUPAC name | 1-methyl-7-(trifluoromethyl)indole-2,3-dione |
| InChIKey | JAXOXOOOXCOXAN-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC=C2C(F)(F)F)C(=O)C1=O |
Computed by PubChem (NCBI)