cas: 1092305-02-6 — see every product listed under this CAS number, including other names
1-N-Methyl-3-(trifluoromethyl)benzene-1,4-diamine, 95% (CAS 1092305-02-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1139971-10g |
| cas | 1092305-02-6 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 17842.30 Pln | |
| AmBeed | 5g | 11918.20 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-N-methyl-2-(trifluoromethyl)benzene-1,4-diamine (CAS 1092305-02-6) is a chemical compound with the molecular formula C8H9F3N2 and a molecular weight of 190.17 g/mol. IUPAC name: 4-N-methyl-2-(trifluoromethyl)benzene-1,4-diamine. InChIKey: CELZLLGYMCAGSW-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2 |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | 4-N-methyl-2-(trifluoromethyl)benzene-1,4-diamine |
| InChIKey | CELZLLGYMCAGSW-UHFFFAOYSA-N |
| SMILES | CNC1=CC(=C(C=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)