CAS 35179-55-6 appears in our catalog under these names: 3-(Trifluoromethyl)-4,5,6,7-tetrahydro-1h-indazole, 98%, 3–(Trifluoromethyl)–4,5,6,7–tetrahydro–1H–indazole, 3-(Trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazole 98%, 4,5,6,7-Tetrahydro-3-(trifluoromethyl)-1H-indazole, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 100mg, 250mg.
3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazole (CAS 35179-55-6) is a chemical compound with the molecular formula C8H9F3N2 and a molecular weight of 190.17 g/mol. IUPAC name: 3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazole. InChIKey: KTULFINKQNWXNY-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2 |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | 3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazole |
| InChIKey | KTULFINKQNWXNY-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NN2)C(F)(F)F |
Computed by PubChem (NCBI)