Products 886371-51-3
CAS 886371-51-3 appears in our catalog under these names: 4-(1-Amino-2,2,2-trifluoro-ethyl)-phenylamine, 95%, 4-(1-Amino-2,2,2-trifluoroethyl)aniline, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 50mg.
4-(1-amino-2,2,2-trifluoroethyl)aniline (CAS 886371-51-3) is a chemical compound with the molecular formula C8H9F3N2 and a molecular weight of 190.17 g/mol. IUPAC name: 4-(1-amino-2,2,2-trifluoroethyl)aniline. InChIKey: OBHDPXUAHBSVPI-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2 |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | 4-(1-amino-2,2,2-trifluoroethyl)aniline |
| InChIKey | OBHDPXUAHBSVPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)N)N |
Computed by PubChem (NCBI)