CAS 886364-82-5 appears in our catalog under these names: (1-[6-(Trifluoromethyl)pyridin-3-yl]ethyl)amine, 95%, 1-(6-(Trifluoromethyl)pyridin-3-yl)ethanamine 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 100mg, 250mg.
1-[6-(trifluoromethyl)-3-pyridinyl]ethanamine (CAS 886364-82-5) is a chemical compound with the molecular formula C8H9F3N2 and a molecular weight of 190.17 g/mol. IUPAC name: 1-[6-(trifluoromethyl)-3-pyridinyl]ethanamine. InChIKey: HBSGXPCKIDZNIF-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2 |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | 1-[6-(trifluoromethyl)-3-pyridinyl]ethanamine |
| InChIKey | HBSGXPCKIDZNIF-UHFFFAOYSA-N |
| SMILES | CC(C1=CN=C(C=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)