CAS 1092305-02-6 appears in our catalog under these names: 1-N-Methyl-3-(trifluoromethyl)benzene-1,4-diamine, 97%, 1-N-Methyl-3-(trifluoromethyl)benzene-1,4-diamine, 95%, 1-N-Methyl-3-(trifluoromethyl)benzene-1,4-diamine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 50mg, 0,5g.
4-N-methyl-2-(trifluoromethyl)benzene-1,4-diamine (CAS 1092305-02-6) is a chemical compound with the molecular formula C8H9F3N2 and a molecular weight of 190.17 g/mol. IUPAC name: 4-N-methyl-2-(trifluoromethyl)benzene-1,4-diamine. InChIKey: CELZLLGYMCAGSW-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2 |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | 4-N-methyl-2-(trifluoromethyl)benzene-1,4-diamine |
| InChIKey | CELZLLGYMCAGSW-UHFFFAOYSA-N |
| SMILES | CNC1=CC(=C(C=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)