cas: 6974-32-9 — see every product listed under this CAS number, including other names
1-O-Acetyl-2,3,5-tri-O-benzoyl-beta-D-ribofuranose, 98%, 98% (CAS 6974-32-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1178O5-5g |
| cas | 6974-32-9 |
| size | 5g |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 69.20 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 74.00 Pln | |
| Chemat | 50g | 88.40 Pln | |
| Chemat | 100g | 117.20 Pln | |
| Chemat | 250g | 194.00 Pln | |
| Chemat | 500g | 388.80 Pln | |
| Chemat | 1kg | 578.00 Pln | |
| Chemat | 5kg | 3048.00 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[(2R,3R,4R,5S)-5-acetyloxy-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate (CAS 6974-32-9) is a chemical compound with the molecular formula C28H24O9 and a molecular weight of 504.5 g/mol. IUPAC name: [(2R,3R,4R,5S)-5-acetyloxy-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate. InChIKey: GCZABPLTDYVJMP-CBUXHAPBSA-N.
| Molecular formula | C28H24O9 |
|---|---|
| Molecular weight | 504.5 g/mol |
| IUPAC name | [(2R,3R,4R,5S)-5-acetyloxy-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
| InChIKey | GCZABPLTDYVJMP-CBUXHAPBSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@@H]([C@H](O1)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)