CAS 151013-37-5 appears in our catalog under these names: Bequinostatin A, Bequinostatin A. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, Get quote.
1,6,7,9,11-pentahydroxy-8,13-dioxo-3-pentyl-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid (CAS 151013-37-5) is a chemical compound with the molecular formula C28H24O9 and a molecular weight of 504.5 g/mol. IUPAC name: 1,6,7,9,11-pentahydroxy-8,13-dioxo-3-pentyl-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid. InChIKey: RKXRXHADKSOULC-UHFFFAOYSA-N.
| Molecular formula | C28H24O9 |
|---|---|
| Molecular weight | 504.5 g/mol |
| IUPAC name | 1,6,7,9,11-pentahydroxy-8,13-dioxo-3-pentyl-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid |
| InChIKey | RKXRXHADKSOULC-UHFFFAOYSA-N |
| SMILES | CCCCCC1=C(C(=C2C(=C1)CC(C3=C(C4=C(C=C32)C(=O)C5=C(C4=O)C(=CC(=C5)O)O)O)O)O)C(=O)O |
Computed by PubChem (NCBI)