CAS 26287-72-9 is the registry number for 1-O-Acetyl-2,3,5-tri-O-benzoyl-L-ribose. Offered by: TRC, Biosynth. Available pack sizes: 1g, 250mg, 500mg, 5000mg, 1000mg.
[(2S,3S,4S)-5-acetyloxy-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate (CAS 26287-72-9) is a chemical compound with the molecular formula C28H24O9 and a molecular weight of 504.5 g/mol. IUPAC name: [(2S,3S,4S)-5-acetyloxy-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate. InChIKey: GCZABPLTDYVJMP-SXBSXPTQSA-N.
| Molecular formula | C28H24O9 |
|---|---|
| Molecular weight | 504.5 g/mol |
| IUPAC name | [(2S,3S,4S)-5-acetyloxy-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
| InChIKey | GCZABPLTDYVJMP-SXBSXPTQSA-N |
| SMILES | CC(=O)OC1[C@H]([C@H]([C@@H](O1)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)